CAS 141344-03-8 is the registry number for Adenosine Impurity 26. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol (CAS 141344-03-8) is a chemical compound with the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. IUPAC name: (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol. InChIKey: NOCJSDWFAHJQDY-NJUACVTBSA-N.
| Molecular formula | C11H14N6O3 |
|---|---|
| Molecular weight | 278.27 g/mol |
| IUPAC name | (2R,3S,5R)-5-(2,6-diaminopurin-9-yl)-2-(hydroxymethyl)-4-methylideneoxolan-3-ol |
| InChIKey | NOCJSDWFAHJQDY-NJUACVTBSA-N |
| SMILES | C=C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)N)N)CO)O |
Computed by PubChem (NCBI)