Products 1416059-51-2
CAS 1416059-51-2 is the registry number for 2-Formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1416059-51-2) is a chemical compound with the molecular formula C14H16BNO3 and a molecular weight of 257.09 g/mol. IUPAC name: 2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: YLSNVGCMHDCOLB-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO3 |
|---|---|
| Molecular weight | 257.09 g/mol |
| IUPAC name | 2-formyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | YLSNVGCMHDCOLB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)C=O |
Computed by PubChem (NCBI)