CAS 1416263-36-9 appears in our catalog under these names: Ezetimibe Impurity 82, Ezetimibe Impurity 75. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,6S)-3-[(S)-(4-fluoroanilino)-(4-phenylmethoxyphenyl)methyl]-6-(4-fluorophenyl)oxan-2-one (CAS 1416263-36-9) is a chemical compound with the molecular formula C31H27F2NO3 and a molecular weight of 499.5 g/mol. IUPAC name: (3R,6S)-3-[(S)-(4-fluoroanilino)-(4-phenylmethoxyphenyl)methyl]-6-(4-fluorophenyl)oxan-2-one. InChIKey: ISQMQHNWBSQAAD-DYIKCSJPSA-N.
| Molecular formula | C31H27F2NO3 |
|---|---|
| Molecular weight | 499.5 g/mol |
| IUPAC name | (3R,6S)-3-[(S)-(4-fluoroanilino)-(4-phenylmethoxyphenyl)methyl]-6-(4-fluorophenyl)oxan-2-one |
| InChIKey | ISQMQHNWBSQAAD-DYIKCSJPSA-N |
| SMILES | C1C[C@H](OC(=O)[C@H]1[C@@H](C2=CC=C(C=C2)OCC3=CC=CC=C3)NC4=CC=C(C=C4)F)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)