CAS 1427556-45-3 is the registry number for N-([1,1'-Biphenyl]-3-yl)dibenzo[b,d]furan-3-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(3-phenylphenyl)dibenzofuran-3-amine (CAS 1427556-45-3) is a chemical compound with the molecular formula C24H17NO and a molecular weight of 335.4 g/mol. IUPAC name: N-(3-phenylphenyl)dibenzofuran-3-amine. InChIKey: ZMVCBGDQPGHDFF-UHFFFAOYSA-N.
| Molecular formula | C24H17NO |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | N-(3-phenylphenyl)dibenzofuran-3-amine |
| InChIKey | ZMVCBGDQPGHDFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=CC4=C(C=C3)C5=CC=CC=C5O4 |
Computed by PubChem (NCBI)