Products 142849-53-4
CAS 142849-53-4 is the registry number for CSPD substrate. Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;[3-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] phosphate (CAS 142849-53-4) is a chemical compound with the molecular formula C18H20ClNa2O7P and a molecular weight of 460.8 g/mol. IUPAC name: disodium;[3-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] phosphate. InChIKey: AASGHQHJTWUGDK-UHFFFAOYSA-L.
| Molecular formula | C18H20ClNa2O7P |
|---|---|
| Molecular weight | 460.8 g/mol |
| IUPAC name | disodium;[3-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)phenyl] phosphate |
| InChIKey | AASGHQHJTWUGDK-UHFFFAOYSA-L |
| SMILES | COC1(C2(C3CC4CC2CC(C4)(C3)Cl)OO1)C5=CC(=CC=C5)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)