Products 143323-42-6

CAS 143323-42-6 is the registry number for Diethyl 5-nitro-2-oxo-6-phenyl-1,2-dihydropyridine-3,4-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Diethyl 5-nitro-2-oxo-6-phenyl-1H-pyridine-3,4-dicarboxylate (CAS 143323-42-6) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: diethyl 5-nitro-2-oxo-6-phenyl-1H-pyridine-3,4-dicarboxylate. InChIKey: QZKSNEQBXATZAN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N2O7
Molecular weight360.3 g/mol
IUPAC namediethyl 5-nitro-2-oxo-6-phenyl-1H-pyridine-3,4-dicarboxylate
InChIKeyQZKSNEQBXATZAN-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=O)NC(=C1[N+](=O)[O-])C2=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)