CAS 143323-42-6 is the registry number for Diethyl 5-nitro-2-oxo-6-phenyl-1,2-dihydropyridine-3,4-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Diethyl 5-nitro-2-oxo-6-phenyl-1H-pyridine-3,4-dicarboxylate (CAS 143323-42-6) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: diethyl 5-nitro-2-oxo-6-phenyl-1H-pyridine-3,4-dicarboxylate. InChIKey: QZKSNEQBXATZAN-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | diethyl 5-nitro-2-oxo-6-phenyl-1H-pyridine-3,4-dicarboxylate |
| InChIKey | QZKSNEQBXATZAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)NC(=C1[N+](=O)[O-])C2=CC=CC=C2)C(=O)OCC |
Computed by PubChem (NCBI)