CAS 1434286-69-7 appears in our catalog under these names: 2-(Dibenzo[b,d]thiophen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(Dibenzo[b,d]thiophen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-dibenzothiophen-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1434286-69-7) is a chemical compound with the molecular formula C18H19BO2S and a molecular weight of 310.2 g/mol. IUPAC name: 2-dibenzothiophen-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VJDXNNHLTDFBRI-UHFFFAOYSA-N.
| Molecular formula | C18H19BO2S |
|---|---|
| Molecular weight | 310.2 g/mol |
| IUPAC name | 2-dibenzothiophen-1-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VJDXNNHLTDFBRI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C4=CC=CC=C4SC3=CC=C2 |
Computed by PubChem (NCBI)