CAS 143660-08-6 is the registry number for 6-Amino-3,5-dicyano-4-phenylpicolinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-amino-3,5-dicyano-4-phenylpyridine-2-carboxylic acid (CAS 143660-08-6) is a chemical compound with the molecular formula C14H8N4O2 and a molecular weight of 264.24 g/mol. IUPAC name: 6-amino-3,5-dicyano-4-phenylpyridine-2-carboxylic acid. InChIKey: RHWODNDGFNGNLY-UHFFFAOYSA-N.
| Molecular formula | C14H8N4O2 |
|---|---|
| Molecular weight | 264.24 g/mol |
| IUPAC name | 6-amino-3,5-dicyano-4-phenylpyridine-2-carboxylic acid |
| InChIKey | RHWODNDGFNGNLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=NC(=C2C#N)N)C(=O)O)C#N |
Computed by PubChem (NCBI)