CAS 1442660-65-2 appears in our catalog under these names: Decitabine Impurity 41, Decitabine Impurity 21, Decitabine Impurity 31. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate (CAS 1442660-65-2) is a chemical compound with the molecular formula C15H15ClN4O5 and a molecular weight of 366.75 g/mol. IUPAC name: [(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate. InChIKey: UVROVUAKLKWNJC-IJLUTSLNSA-N.
| Molecular formula | C15H15ClN4O5 |
|---|---|
| Molecular weight | 366.75 g/mol |
| IUPAC name | [(2R,3R,5R)-5-(4-amino-2-oxo-1,3,5-triazin-1-yl)-3-hydroxyoxolan-2-yl]methyl 4-chlorobenzoate |
| InChIKey | UVROVUAKLKWNJC-IJLUTSLNSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1N2C=NC(=NC2=O)N)COC(=O)C3=CC=C(C=C3)Cl)O |
Computed by PubChem (NCBI)