CAS 1443421-70-2 is the registry number for Abacavir N-Oxide. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,4R)-4-[2-amino-6-(cyclopropylamino)-7-oxidopurin-7-ium-9-yl]cyclopent-2-en-1-yl]methanol (CAS 1443421-70-2) is a chemical compound with the molecular formula C14H18N6O2 and a molecular weight of 302.33 g/mol. IUPAC name: [(1S,4R)-4-[2-amino-6-(cyclopropylamino)-7-oxidopurin-7-ium-9-yl]cyclopent-2-en-1-yl]methanol. InChIKey: IPMLFHYLIHZKEE-SCZZXKLOSA-N.
| Molecular formula | C14H18N6O2 |
|---|---|
| Molecular weight | 302.33 g/mol |
| IUPAC name | [(1S,4R)-4-[2-amino-6-(cyclopropylamino)-7-oxidopurin-7-ium-9-yl]cyclopent-2-en-1-yl]methanol |
| InChIKey | IPMLFHYLIHZKEE-SCZZXKLOSA-N |
| SMILES | C1CC1NC2=C3C(=NC(=N2)N)N(C=[N+]3[O-])[C@@H]4C[C@@H](C=C4)CO |
Computed by PubChem (NCBI)