CAS 14441-14-6 is the registry number for Cefotaxime Impurity 33. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
CAS 14441-14-6 identifies a chemical compound with the molecular formula C8H10N2NaO4S and a molecular weight of 253.23 g/mol. InChIKey: FZGWDTQYLVCFDD-UHFFFAOYSA-N.
| Molecular formula | C8H10N2NaO4S |
|---|---|
| Molecular weight | 253.23 g/mol |
| InChIKey | FZGWDTQYLVCFDD-UHFFFAOYSA-N |
| SMILES | C1C(=C(N2C(S1)C(C2=O)N)C(=O)O)CO.[Na] |
Computed by PubChem (NCBI)