CAS 1448417-84-2 is the registry number for Argatroban Impurity 64. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylic acid (CAS 1448417-84-2) is a chemical compound with the molecular formula C13H24N6O5 and a molecular weight of 344.37 g/mol. IUPAC name: (2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylic acid. InChIKey: PNKJLCTWLGNOAR-KXUCPTDWSA-N.
| Molecular formula | C13H24N6O5 |
|---|---|
| Molecular weight | 344.37 g/mol |
| IUPAC name | (2R,4R)-1-[(2S)-2-amino-5-[[amino(nitramido)methylidene]amino]pentanoyl]-4-methylpiperidine-2-carboxylic acid |
| InChIKey | PNKJLCTWLGNOAR-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N[N+](=O)[O-])N |
Computed by PubChem (NCBI)