CAS 1451058-40-4 is the registry number for ETHYL 4-(5-(1H-BENZO[D]IMIDAZOL-2-YL)FURAN-2-YL)BENZIMIDATE DIHYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4-[5-(1H-benzimidazol-2-yl)furan-2-yl]benzenecarboximidate;dihydrochloride (CAS 1451058-40-4) is a chemical compound with the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.3 g/mol. IUPAC name: ethyl 4-[5-(1H-benzimidazol-2-yl)furan-2-yl]benzenecarboximidate;dihydrochloride. InChIKey: QLWXJGGVIHMZPH-UHFFFAOYSA-N.
| Molecular formula | C20H19Cl2N3O2 |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | ethyl 4-[5-(1H-benzimidazol-2-yl)furan-2-yl]benzenecarboximidate;dihydrochloride |
| InChIKey | QLWXJGGVIHMZPH-UHFFFAOYSA-N |
| SMILES | CCOC(=N)C1=CC=C(C=C1)C2=CC=C(O2)C3=NC4=CC=CC=C4N3.Cl.Cl |
Computed by PubChem (NCBI)