CAS 145877-52-7 appears in our catalog under these names: CP 122721 hydrochloride, CP 122721 (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 25mg, 5mg, 5 mg, 1 mg.
(2S,3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride (CAS 145877-52-7) is a chemical compound with the molecular formula C20H25Cl2F3N2O2 and a molecular weight of 453.3 g/mol. IUPAC name: (2S,3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride. InChIKey: AVTRGAPFNJEOTQ-FFUVTKDNSA-N.
| Molecular formula | C20H25Cl2F3N2O2 |
|---|---|
| Molecular weight | 453.3 g/mol |
| IUPAC name | (2S,3S)-N-[[2-methoxy-5-(trifluoromethoxy)phenyl]methyl]-2-phenylpiperidin-3-amine;dihydrochloride |
| InChIKey | AVTRGAPFNJEOTQ-FFUVTKDNSA-N |
| SMILES | COC1=C(C=C(C=C1)OC(F)(F)F)CN[C@H]2CCCN[C@H]2C3=CC=CC=C3.Cl.Cl |
Computed by PubChem (NCBI)