CAS 1459128-79-0 is the registry number for 2',5'-Diethoxy-[1,1':4',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[4-(3,5-dicarboxyphenyl)-2,5-diethoxyphenyl]benzene-1,3-dicarboxylic acid (CAS 1459128-79-0) is a chemical compound with the molecular formula C26H22O10 and a molecular weight of 494.4 g/mol. IUPAC name: 5-[4-(3,5-dicarboxyphenyl)-2,5-diethoxyphenyl]benzene-1,3-dicarboxylic acid. InChIKey: OPSBOEJKRCWAOK-UHFFFAOYSA-N.
| Molecular formula | C26H22O10 |
|---|---|
| Molecular weight | 494.4 g/mol |
| IUPAC name | 5-[4-(3,5-dicarboxyphenyl)-2,5-diethoxyphenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | OPSBOEJKRCWAOK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)OCC)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)