CAS 147265-75-6 is the registry number for 1-(1,2,3,4-tetrahydroquinolin-7-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(1,2,3,4-tetrahydroquinolin-7-yl)ethanone (CAS 147265-75-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-(1,2,3,4-tetrahydroquinolin-7-yl)ethanone. InChIKey: QWNZBFWAQSPYIG-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1-(1,2,3,4-tetrahydroquinolin-7-yl)ethanone |
| InChIKey | QWNZBFWAQSPYIG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(CCCN2)C=C1 |
Computed by PubChem (NCBI)