CAS 14751-45-2 is the registry number for (8-Aminoquinoline)dichloroCopper, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-ylazanide;dichlorocopper (CAS 14751-45-2) is a chemical compound with the molecular formula C9H16Cl2CuN2-2 and a molecular weight of 286.69 g/mol. IUPAC name: 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-ylazanide;dichlorocopper. InChIKey: HJBLRNGQJXGJOS-UHFFFAOYSA-L.
| Molecular formula | C9H16Cl2CuN2-2 |
|---|---|
| Molecular weight | 286.69 g/mol |
| IUPAC name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-id-8-ylazanide;dichlorocopper |
| InChIKey | HJBLRNGQJXGJOS-UHFFFAOYSA-L |
| SMILES | C1CC2CCC[N-]C2C(C1)[NH-].Cl[Cu]Cl |
Computed by PubChem (NCBI)