CAS 1478663-99-8 appears in our catalog under these names: Ezetimibe Impurity 93, Ezetimibe Impurity 86. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one (CAS 1478663-99-8) is a chemical compound with the molecular formula C24H19F2NO3 and a molecular weight of 407.4 g/mol. IUPAC name: (3R,4R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one. InChIKey: UEPZDXMEEKCJSP-GGAORHGYSA-N.
| Molecular formula | C24H19F2NO3 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | (3R,4R)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
| InChIKey | UEPZDXMEEKCJSP-GGAORHGYSA-N |
| SMILES | C1=CC(=CC=C1[C@H]2[C@H](C(=O)N2C3=CC=C(C=C3)F)CCC(=O)C4=CC=C(C=C4)F)O |
Computed by PubChem (NCBI)