CAS 148950-50-9 is the registry number for Clonidine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,6-dichlorophenyl)-1,3-dinitrosoimidazolidin-2-imine (CAS 148950-50-9) is a chemical compound with the molecular formula C9H7Cl2N5O2 and a molecular weight of 288.09 g/mol. IUPAC name: N-(2,6-dichlorophenyl)-1,3-dinitrosoimidazolidin-2-imine. InChIKey: BHCVTAHNEULWRQ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N5O2 |
|---|---|
| Molecular weight | 288.09 g/mol |
| IUPAC name | N-(2,6-dichlorophenyl)-1,3-dinitrosoimidazolidin-2-imine |
| InChIKey | BHCVTAHNEULWRQ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=NC2=C(C=CC=C2Cl)Cl)N1N=O)N=O |
Computed by PubChem (NCBI)