CAS 149775-40-6 is the registry number for 2-(6-Bromo-2-pyridinyl)quinoline, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(6-bromo-2-pyridinyl)quinoline (CAS 149775-40-6) is a chemical compound with the molecular formula C14H9BrN2 and a molecular weight of 285.14 g/mol. IUPAC name: 2-(6-bromo-2-pyridinyl)quinoline. InChIKey: TXRONHBAQSMETR-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2 |
|---|---|
| Molecular weight | 285.14 g/mol |
| IUPAC name | 2-(6-bromo-2-pyridinyl)quinoline |
| InChIKey | TXRONHBAQSMETR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=NC(=CC=C3)Br |
Computed by PubChem (NCBI)