Products 1498569-52-0
CAS 1498569-52-0 is the registry number for 2-bromo-N-(2,6-dioxo-3-piperidyl)acetamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
2-bromo-N-(2,6-dioxopiperidin-3-yl)acetamide (CAS 1498569-52-0) is a chemical compound with the molecular formula C7H9BrN2O3 and a molecular weight of 249.06 g/mol. IUPAC name: 2-bromo-N-(2,6-dioxopiperidin-3-yl)acetamide. InChIKey: OCZXUXNTEJVQFU-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O3 |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 2-bromo-N-(2,6-dioxopiperidin-3-yl)acetamide |
| InChIKey | OCZXUXNTEJVQFU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1NC(=O)CBr |
Computed by PubChem (NCBI)