CAS 149882-18-8 is the registry number for Posaconazole Impurity 172. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol (CAS 149882-18-8) is a chemical compound with the molecular formula C14H15F2N3O2 and a molecular weight of 295.28 g/mol. IUPAC name: [(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol. InChIKey: YGEFLWFVJLRJDL-IINYFYTJSA-N.
| Molecular formula | C14H15F2N3O2 |
|---|---|
| Molecular weight | 295.28 g/mol |
| IUPAC name | [(3S,5S)-5-(2,4-difluorophenyl)-5-(1,2,4-triazol-1-ylmethyl)oxolan-3-yl]methanol |
| InChIKey | YGEFLWFVJLRJDL-IINYFYTJSA-N |
| SMILES | C1[C@H](CO[C@]1(CN2C=NC=N2)C3=C(C=C(C=C3)F)F)CO |
Computed by PubChem (NCBI)