CAS 1499185-21-5 is the registry number for 4′-Phosphono[1,1′-biphenyl]-3,5-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-phosphonophenyl)benzene-1,3-dicarboxylic acid (CAS 1499185-21-5) is a chemical compound with the molecular formula C14H11O7P and a molecular weight of 322.21 g/mol. IUPAC name: 5-(4-phosphonophenyl)benzene-1,3-dicarboxylic acid. InChIKey: MTALCIOQQMCQMH-UHFFFAOYSA-N.
| Molecular formula | C14H11O7P |
|---|---|
| Molecular weight | 322.21 g/mol |
| IUPAC name | 5-(4-phosphonophenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | MTALCIOQQMCQMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)P(=O)(O)O |
Computed by PubChem (NCBI)