Products 1499185-21-5

CAS 1499185-21-5 is the registry number for 4′-Phosphono[1,1′-biphenyl]-3,5-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(4-phosphonophenyl)benzene-1,3-dicarboxylic acid (CAS 1499185-21-5) is a chemical compound with the molecular formula C14H11O7P and a molecular weight of 322.21 g/mol. IUPAC name: 5-(4-phosphonophenyl)benzene-1,3-dicarboxylic acid. InChIKey: MTALCIOQQMCQMH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11O7P
Molecular weight322.21 g/mol
IUPAC name5-(4-phosphonophenyl)benzene-1,3-dicarboxylic acid
InChIKeyMTALCIOQQMCQMH-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)P(=O)(O)O

Computed by PubChem (NCBI)