Products 149946-97-4
CAS 149946-97-4 is the registry number for α-Ethenyl-3,5-bis(trifluoromethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[3,5-bis(trifluoromethyl)phenyl]prop-2-en-1-ol (CAS 149946-97-4) is a chemical compound with the molecular formula C11H8F6O and a molecular weight of 270.17 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]prop-2-en-1-ol. InChIKey: PZDSGGSNTIUCDB-UHFFFAOYSA-N.
| Molecular formula | C11H8F6O |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]prop-2-en-1-ol |
| InChIKey | PZDSGGSNTIUCDB-UHFFFAOYSA-N |
| SMILES | C=CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)