CAS 1503368-65-7 is the registry number for 3-(6-Bromo-2-(1-chloroethyl)-3H-imidazo[4,5-b]pyridin-3-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide (CAS 1503368-65-7) is a chemical compound with the molecular formula C13H15BrClN3O2S and a molecular weight of 392.70 g/mol. IUPAC name: 3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide. InChIKey: DYJTVONMFSGCDP-UHFFFAOYSA-N.
| Molecular formula | C13H15BrClN3O2S |
|---|---|
| Molecular weight | 392.70 g/mol |
| IUPAC name | 3-[6-bromo-2-(1-chloroethyl)imidazo[4,5-b]pyridin-3-yl]thiane 1,1-dioxide |
| InChIKey | DYJTVONMFSGCDP-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(N1C3CCCS(=O)(=O)C3)N=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)