Products 1508282-87-8
CAS 1508282-87-8 is the registry number for Ilaprazole Impurity 53. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-4-oxo-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridine-2-carboxylic acid (CAS 1508282-87-8) is a chemical compound with the molecular formula C18H14N4O3 and a molecular weight of 334.3 g/mol. IUPAC name: 5-methyl-4-oxo-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridine-2-carboxylic acid. InChIKey: YHQPOIURPKUTSG-UHFFFAOYSA-N.
| Molecular formula | C18H14N4O3 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 5-methyl-4-oxo-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridine-2-carboxylic acid |
| InChIKey | YHQPOIURPKUTSG-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=CC1=O)C(=O)O)C2=NC3=C(N2)C=C(C=C3)N4C=CC=C4 |
Computed by PubChem (NCBI)