CAS 1512251-26-1 is the registry number for 1,2-Dimethyl-5-(propan-2-yl)-1h-pyrrole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1,2-dimethyl-5-propan-2-ylpyrrole-3-carboxylic acid (CAS 1512251-26-1) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: 1,2-dimethyl-5-propan-2-ylpyrrole-3-carboxylic acid. InChIKey: YOCPFOLAKBFBKK-UHFFFAOYSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | 1,2-dimethyl-5-propan-2-ylpyrrole-3-carboxylic acid |
| InChIKey | YOCPFOLAKBFBKK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(N1C)C(C)C)C(=O)O |
Computed by PubChem (NCBI)