Products 1512463-43-2
CAS 1512463-43-2 is the registry number for 3-(4-Chlorophenyl)-1,4-diazepan-2-one, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3-(4-chlorophenyl)-1,4-diazepan-2-one (CAS 1512463-43-2) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,4-diazepan-2-one. InChIKey: SQNBLEBSBPDART-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,4-diazepan-2-one |
| InChIKey | SQNBLEBSBPDART-UHFFFAOYSA-N |
| SMILES | C1CNC(C(=O)NC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)