CAS 1519345-85-7 is the registry number for 3-(4-Amino-6-methyl-1H-pyrazolo[3,4-d]pyrimidin-1-yl)-3-methyltetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS 1519345-85-7) is a chemical compound with the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. IUPAC name: 6-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: NULCJDLTVBOPBZ-UHFFFAOYSA-N.
| Molecular formula | C11H15N5O2S |
|---|---|
| Molecular weight | 281.34 g/mol |
| IUPAC name | 6-methyl-1-(3-methyl-1,1-dioxothiolan-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | NULCJDLTVBOPBZ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C2C=NN(C2=N1)C3(CCS(=O)(=O)C3)C)N |
Computed by PubChem (NCBI)