Products 152368-69-9
CAS 152368-69-9 is the registry number for 4,4'-([1,1'-Biphenyl]-2,2'-diylbis(oxy))dibenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2-[2-(4-carboxyphenoxy)phenyl]phenoxy]benzoic acid (CAS 152368-69-9) is a chemical compound with the molecular formula C26H18O6 and a molecular weight of 426.4 g/mol. IUPAC name: 4-[2-[2-(4-carboxyphenoxy)phenyl]phenoxy]benzoic acid. InChIKey: WOLQZVNVZAUDKK-UHFFFAOYSA-N.
| Molecular formula | C26H18O6 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | 4-[2-[2-(4-carboxyphenoxy)phenyl]phenoxy]benzoic acid |
| InChIKey | WOLQZVNVZAUDKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=C2OC3=CC=C(C=C3)C(=O)O)OC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)