Products 153227-04-4
CAS 153227-04-4 is the registry number for LY306669. Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 4-ethyl-2-(3-fluorophenyl)-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate (CAS 153227-04-4) is a chemical compound with the molecular formula C23H28FN4NaO2 and a molecular weight of 434.5 g/mol. IUPAC name: sodium 4-ethyl-2-(3-fluorophenyl)-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate. InChIKey: KZDVNZZCFSABBQ-UHFFFAOYSA-M.
| Molecular formula | C23H28FN4NaO2 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | sodium 4-ethyl-2-(3-fluorophenyl)-5-[6-methyl-6-(2H-tetrazol-5-yl)heptoxy]phenolate |
| InChIKey | KZDVNZZCFSABBQ-UHFFFAOYSA-M |
| SMILES | CCC1=CC(=C(C=C1OCCCCCC(C)(C)C2=NNN=N2)[O-])C3=CC(=CC=C3)F.[Na+] |
Computed by PubChem (NCBI)