CAS 153324-46-0 is the registry number for (2R,3S,4S,5R,6R)-2-(Acetoxymethyl)-6-(2-aminoethoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-aminoethoxy)oxan-2-yl]methyl acetate (CAS 153324-46-0) is a chemical compound with the molecular formula C16H25NO10 and a molecular weight of 391.37 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-aminoethoxy)oxan-2-yl]methyl acetate. InChIKey: JAISDYXOOAVUCZ-LYYZXLFJSA-N.
| Molecular formula | C16H25NO10 |
|---|---|
| Molecular weight | 391.37 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-aminoethoxy)oxan-2-yl]methyl acetate |
| InChIKey | JAISDYXOOAVUCZ-LYYZXLFJSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OCCN)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)