CAS 153522-54-4 is the registry number for Efinaconazole Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-3-(2,4-difluorophenyl)-3-methylsulfonyloxy-4-(1,2,4-triazol-1-yl)butan-2-yl] methanesulfonate (CAS 153522-54-4) is a chemical compound with the molecular formula C14H17F2N3O6S2 and a molecular weight of 425.4 g/mol. IUPAC name: [(2R,3R)-3-(2,4-difluorophenyl)-3-methylsulfonyloxy-4-(1,2,4-triazol-1-yl)butan-2-yl] methanesulfonate. InChIKey: JLGRHAPUDWFANP-QMTHXVAHSA-N.
| Molecular formula | C14H17F2N3O6S2 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | [(2R,3R)-3-(2,4-difluorophenyl)-3-methylsulfonyloxy-4-(1,2,4-triazol-1-yl)butan-2-yl] methanesulfonate |
| InChIKey | JLGRHAPUDWFANP-QMTHXVAHSA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)OS(=O)(=O)C)OS(=O)(=O)C |
Computed by PubChem (NCBI)