CAS 1535288-37-9 is the registry number for 6,7,8-Trifluoroisoquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,7,8-trifluoroisoquinoline (CAS 1535288-37-9) is a chemical compound with the molecular formula C9H4F3N and a molecular weight of 183.13 g/mol. IUPAC name: 6,7,8-trifluoroisoquinoline. InChIKey: FODLALJNENMOHB-UHFFFAOYSA-N.
| Molecular formula | C9H4F3N |
|---|---|
| Molecular weight | 183.13 g/mol |
| IUPAC name | 6,7,8-trifluoroisoquinoline |
| InChIKey | FODLALJNENMOHB-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C(C(=C(C=C21)F)F)F |
Computed by PubChem (NCBI)