CAS 153633-12-6 is the registry number for Ethyl 6,7-dibromo-5-hydroxy-1-methyl-2-[(phenylthio)methyl]-1H-indole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 6,7-dibromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate (CAS 153633-12-6) is a chemical compound with the molecular formula C19H17Br2NO3S and a molecular weight of 499.2 g/mol. IUPAC name: ethyl 6,7-dibromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate. InChIKey: WTZMWLAFHMRRDG-UHFFFAOYSA-N.
| Molecular formula | C19H17Br2NO3S |
|---|---|
| Molecular weight | 499.2 g/mol |
| IUPAC name | ethyl 6,7-dibromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate |
| InChIKey | WTZMWLAFHMRRDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=C(C(=C(C=C12)O)Br)Br)C)CSC3=CC=CC=C3 |
Computed by PubChem (NCBI)