Products 1536479-20-5
CAS 1536479-20-5 is the registry number for 3-methyl-6-(trifluoromethyl)-2,3-dihydro-1H-indol-2-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
3-methyl-6-(trifluoromethyl)-1,3-dihydroindol-2-one (CAS 1536479-20-5) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 3-methyl-6-(trifluoromethyl)-1,3-dihydroindol-2-one. InChIKey: CQJFALYHVOOIHH-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 3-methyl-6-(trifluoromethyl)-1,3-dihydroindol-2-one |
| InChIKey | CQJFALYHVOOIHH-UHFFFAOYSA-N |
| SMILES | CC1C2=C(C=C(C=C2)C(F)(F)F)NC1=O |
Computed by PubChem (NCBI)