Products 153994-97-9
CAS 153994-97-9 is the registry number for CGP 56999. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(1R)-1-[[(2S)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid (CAS 153994-97-9) is a chemical compound with the molecular formula C19H30NO5P and a molecular weight of 383.4 g/mol. IUPAC name: 3-[(1R)-1-[[(2S)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid. InChIKey: JCFULPDIJOVUHP-KDOFPFPSSA-N.
| Molecular formula | C19H30NO5P |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 3-[(1R)-1-[[(2S)-3-[cyclohexylmethyl(hydroxy)phosphoryl]-2-hydroxypropyl]amino]ethyl]benzoic acid |
| InChIKey | JCFULPDIJOVUHP-KDOFPFPSSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)C(=O)O)NC[C@@H](CP(=O)(CC2CCCCC2)O)O |
Computed by PubChem (NCBI)