Products 154479-90-0
CAS 154479-90-0 is the registry number for (-)-1-(9H-Fluoren-9-yl)ethyl carbonochloridate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(9H-fluoren-9-yl)ethyl carbonochloridate (CAS 154479-90-0) is a chemical compound with the molecular formula C16H13ClO2 and a molecular weight of 272.72 g/mol. IUPAC name: 1-(9H-fluoren-9-yl)ethyl carbonochloridate. InChIKey: SFRVOKMRHPQYGE-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO2 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | 1-(9H-fluoren-9-yl)ethyl carbonochloridate |
| InChIKey | SFRVOKMRHPQYGE-UHFFFAOYSA-N |
| SMILES | CC(C1C2=CC=CC=C2C3=CC=CC=C13)OC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
FLEC, 1-(9-Fluorenyl)ethyl chloroformate, 1-(9H-fluoren-9-yl)ethyl carbonochloridate, (-)-1-(9H-Fluoren-9-yl)ethyl carbonochloridate, (-)-1-(9-fluorenyl)ethyl chloroformate, starbld0002164, (-)-FLEC®, (+)-1-(9H-Fluoren-9-yl)ethyl carbonochloridate, 1-(9-fluorenyl)ethylchloroformate, SFRVOKMRHPQYGE-UHFFFAOYSA-N