Products 1550312-94-1
CAS 1550312-94-1 is the registry number for 5-[(3-Bromophenyl)methyl]-2,4-dihydro-4-methyl-3H-1,2,4-triazole-3-thione, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[(3-bromophenyl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione (CAS 1550312-94-1) is a chemical compound with the molecular formula C10H10BrN3S and a molecular weight of 284.18 g/mol. IUPAC name: 3-[(3-bromophenyl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: UCPWKALTCUSUEB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3S |
|---|---|
| Molecular weight | 284.18 g/mol |
| IUPAC name | 3-[(3-bromophenyl)methyl]-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | UCPWKALTCUSUEB-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)