CAS 155306-73-3 appears in our catalog under these names: Coumarin VIS-463 TM-BQZ Benzimidazole, Absorption maximum (MeOH) = 463 nm, 1 g, Coumarin VIS-463 TM-BQZ Benzimidazole, Absorption maximum (MeOH) = 463 nm, 5 g, Coumarin VIS-463 TM-BQZ Benzimidazole, Absorption maximum (MeOH) = 463 nm, 10 g. Offered by: Roth. Available pack sizes: 1g, 5g, 10g.
5-(1H-benzimidazol-2-yl)-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one (CAS 155306-73-3) is a chemical compound with the molecular formula C26H27N3O2 and a molecular weight of 413.5 g/mol. IUPAC name: 5-(1H-benzimidazol-2-yl)-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one. InChIKey: HQBMTOXZFNIBNW-UHFFFAOYSA-N.
| Molecular formula | C26H27N3O2 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 5-(1H-benzimidazol-2-yl)-10,10,16,16-tetramethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one |
| InChIKey | HQBMTOXZFNIBNW-UHFFFAOYSA-N |
| SMILES | CC1(CCN2CCC(C3=C4C(=CC1=C32)C=C(C(=O)O4)C5=NC6=CC=CC=C6N5)(C)C)C |
Computed by PubChem (NCBI)