Products 1565825-89-9
CAS 1565825-89-9 is the registry number for (R)-1-(3,4-Difluorophenyl)propan-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg.
(1R)-1-(3,4-difluorophenyl)propan-1-amine;hydrochloride (CAS 1565825-89-9) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1R)-1-(3,4-difluorophenyl)propan-1-amine;hydrochloride. InChIKey: BNFNPNSBDYSQAL-SBSPUUFOSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1R)-1-(3,4-difluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | BNFNPNSBDYSQAL-SBSPUUFOSA-N |
| SMILES | CC[C@H](C1=CC(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)