Products 156728-18-6
CAS 156728-18-6 is the registry number for L 684248. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2S)-3,3-dimethyl-1-[[(1R)-1-(4-methylphenyl)butyl]carbamoyl]-4-oxoazetidin-2-yl]oxybenzoic acid (CAS 156728-18-6) is a chemical compound with the molecular formula C24H28N2O5 and a molecular weight of 424.5 g/mol. IUPAC name: 4-[(2S)-3,3-dimethyl-1-[[(1R)-1-(4-methylphenyl)butyl]carbamoyl]-4-oxoazetidin-2-yl]oxybenzoic acid. InChIKey: UYCGRJINXTYRQR-KNQAVFIVSA-N.
| Molecular formula | C24H28N2O5 |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | 4-[(2S)-3,3-dimethyl-1-[[(1R)-1-(4-methylphenyl)butyl]carbamoyl]-4-oxoazetidin-2-yl]oxybenzoic acid |
| InChIKey | UYCGRJINXTYRQR-KNQAVFIVSA-N |
| SMILES | CCC[C@H](C1=CC=C(C=C1)C)NC(=O)N2[C@H](C(C2=O)(C)C)OC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)