CAS 15782-05-5 appears in our catalog under these names: Pigment red 48:3, 95%, Pigment red 48:3. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 500g.
Strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate (CAS 15782-05-5) is a chemical compound with the molecular formula C18H11ClN2O6SSr and a molecular weight of 506.4 g/mol. IUPAC name: strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate. InChIKey: JBMOZNVEFFSGCK-UHFFFAOYSA-L.
| Molecular formula | C18H11ClN2O6SSr |
|---|---|
| Molecular weight | 506.4 g/mol |
| IUPAC name | strontium 2-[(3-carboxy-2-oxidonaphthalen-1-yl)diazenyl]-4-chloro-5-methylbenzenesulfonate |
| InChIKey | JBMOZNVEFFSGCK-UHFFFAOYSA-L |
| SMILES | CC1=CC(=C(C=C1Cl)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)[O-])S(=O)(=O)[O-].[Sr+2] |
Computed by PubChem (NCBI)