CAS 157945-83-0 is the registry number for 2-[(1E)-3,3-Dimethyl-1-buten-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-[(E)-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 157945-83-0) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 2-[(E)-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VTGDQOPDGQPGRO-CMDGGOBGSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 2-[(E)-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VTGDQOPDGQPGRO-CMDGGOBGSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C(C)(C)C |
Computed by PubChem (NCBI)