CAS 1579886-24-0 is the registry number for Luliconazole Impurity L. Offered by: Chemat Brand. Available pack sizes: on request.
(2Z)-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetamide (CAS 1579886-24-0) is a chemical compound with the molecular formula C14H11Cl2N3OS2 and a molecular weight of 372.3 g/mol. IUPAC name: (2Z)-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetamide. InChIKey: APMRUCKYYVVXMP-OWBHPGMISA-N.
| Molecular formula | C14H11Cl2N3OS2 |
|---|---|
| Molecular weight | 372.3 g/mol |
| IUPAC name | (2Z)-2-[4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetamide |
| InChIKey | APMRUCKYYVVXMP-OWBHPGMISA-N |
| SMILES | C1C(S/C(=C(/C(=O)N)\N2C=CN=C2)/S1)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)