CAS 1581642-06-9 is the registry number for 8-((1,4-Diazepan-1-yl)sulfonyl)quinoline hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
8-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride (CAS 1581642-06-9) is a chemical compound with the molecular formula C14H18ClN3O2S and a molecular weight of 327.8 g/mol. IUPAC name: 8-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride. InChIKey: JRNKODVNQKXPRB-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O2S |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | 8-(1,4-diazepan-1-ylsulfonyl)quinoline;hydrochloride |
| InChIKey | JRNKODVNQKXPRB-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2N=CC=C3.Cl |
Computed by PubChem (NCBI)