CAS 1604786-89-1 is the registry number for 4-(3,5-Difluorophenyl)pyrrolidin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(3,5-difluorophenyl)pyrrolidin-2-one (CAS 1604786-89-1) is a chemical compound with the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. IUPAC name: 4-(3,5-difluorophenyl)pyrrolidin-2-one. InChIKey: QBLNGTDDICVLKQ-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO |
|---|---|
| Molecular weight | 197.18 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)pyrrolidin-2-one |
| InChIKey | QBLNGTDDICVLKQ-UHFFFAOYSA-N |
| SMILES | C1C(CNC1=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)