CAS 1605318-09-9 is the registry number for 6-[(4-Fluorophenyl)methyl]-2,3-dihydro-3,3-dimethyl-1H-indole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-[(4-fluorophenyl)methyl]-3,3-dimethyl-1,2-dihydroindole (CAS 1605318-09-9) is a chemical compound with the molecular formula C17H18FN and a molecular weight of 255.33 g/mol. IUPAC name: 6-[(4-fluorophenyl)methyl]-3,3-dimethyl-1,2-dihydroindole. InChIKey: DBTRANSEKHXWMV-UHFFFAOYSA-N.
| Molecular formula | C17H18FN |
|---|---|
| Molecular weight | 255.33 g/mol |
| IUPAC name | 6-[(4-fluorophenyl)methyl]-3,3-dimethyl-1,2-dihydroindole |
| InChIKey | DBTRANSEKHXWMV-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C1C=CC(=C2)CC3=CC=C(C=C3)F)C |
Computed by PubChem (NCBI)