CAS 1609495-95-5 is the registry number for Fluconazole Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)-3-(1,2,4-triazol-4-yl)propan-2-ol (CAS 1609495-95-5) is a chemical compound with the molecular formula C15H14FN9O and a molecular weight of 355.33 g/mol. IUPAC name: 2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)-3-(1,2,4-triazol-4-yl)propan-2-ol. InChIKey: DPOBQQRESAJPPE-UHFFFAOYSA-N.
| Molecular formula | C15H14FN9O |
|---|---|
| Molecular weight | 355.33 g/mol |
| IUPAC name | 2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]-1-(1,2,4-triazol-1-yl)-3-(1,2,4-triazol-4-yl)propan-2-ol |
| InChIKey | DPOBQQRESAJPPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=NC=N2)F)C(CN3C=NN=C3)(CN4C=NC=N4)O |
Computed by PubChem (NCBI)