CAS 1613451-81-2 appears in our catalog under these names: 3,3''-Dihydroxy-2'-methyl-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%, 3,3′′-Dihydroxy-2′-methyl[1,1′:4′,1′′-terphenyl]-4,4′′-dicarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
4-[4-(4-carboxy-3-hydroxyphenyl)-3-methylphenyl]-2-hydroxybenzoic acid (CAS 1613451-81-2) is a chemical compound with the molecular formula C21H16O6 and a molecular weight of 364.3 g/mol. IUPAC name: 4-[4-(4-carboxy-3-hydroxyphenyl)-3-methylphenyl]-2-hydroxybenzoic acid. InChIKey: RDADCBONPAHZEN-UHFFFAOYSA-N.
| Molecular formula | C21H16O6 |
|---|---|
| Molecular weight | 364.3 g/mol |
| IUPAC name | 4-[4-(4-carboxy-3-hydroxyphenyl)-3-methylphenyl]-2-hydroxybenzoic acid |
| InChIKey | RDADCBONPAHZEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC(=C(C=C2)C(=O)O)O)C3=CC(=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)